C9H14N4O — CID 154720397
(1R,2R,3R,4S)-3-azido-N-methylbicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 154720397) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-azido-N-methylbicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,3R,4S)-3-azido-N-methylbicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 154720397 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (1R,2R,3R,4S)-3-azido-N-methylbicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H]2CC[C@@H](C2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C9H14N4O/c1-11-9(14)7-5-2-3-6(4-5)8(7)12-13-10/h5-8H,2-4H2,1H3,(H,11,14)/t5-,6+,7-,8-/m1/s1 |
| InChIKey | MGZYMBFPOLOQEC-ULAWRXDQSA-N |
| XLogP | 1.46 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|