C15H19NO2 — CID 15472097
4,4-dimethyl-2-[(2R,3S)-2-methyl-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazole (PubChem CID 15472097) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(2R,3S)-2-methyl-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[(2R,3S)-2-methyl-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 15472097 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4,4-dimethyl-2-[(2R,3S)-2-methyl-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazole |
| SMILES | Cc1ccc([C@@H]2O[C@@]2(C)C2=NC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C15H19NO2/c1-10-5-7-11(8-6-10)12-15(4,18-12)13-16-14(2,3)9-17-13/h5-8,12H,9H2,1-4H3/t12-,15+/m0/s1 |
| InChIKey | YTEMUDYFFZLPIX-SWLSCSKDSA-N |
| XLogP | 3.03 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|