C17H22F3NO5S — CID 134919510
trifluoromethanesulfonate;3,4,4-trimethyl-2-[(2S,3S)-2-methyl-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazol-3-ium (PubChem CID 134919510) has the molecular formula C17H22F3NO5S and a molecular weight of 409.43 g/mol. Its IUPAC name is trifluoromethanesulfonate;3,4,4-trimethyl-2-[(2S,3S)-2-methyl-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazol-3-ium.
| Compound Name | trifluoromethanesulfonate;3,4,4-trimethyl-2-[(2S,3S)-2-methyl-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 134919510 |
| Molecular Formula | C17H22F3NO5S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | trifluoromethanesulfonate;3,4,4-trimethyl-2-[(2S,3S)-2-methyl-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazol-3-ium |
| SMILES | Cc1ccc([C@@H]2O[C@]2(C)C2=[N+](C)C(C)(C)CO2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H22NO2.CHF3O3S/c1-11-6-8-12(9-7-11)13-16(4,19-13)14-17(5)15(2,3)10-18-14;2-1(3,4)8(5,6)7/h6-9,13H,10H2,1-5H3;(H,5,6,7)/q+1;/p-1/t13-,16-;/m0./s1 |
| InChIKey | JUSHGPUTGLDWFF-LINSIKMZSA-M |
| XLogP | 2.73 |
| TPSA | 81.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|