C26H43NO2Sn — CID 10792071
tributyl-[(2S,3S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-(4-methylphenyl)oxiran-2-yl]stannane (PubChem CID 10792071) has the molecular formula C26H43NO2Sn and a molecular weight of 520.35 g/mol. Its IUPAC name is tributyl-[(2S,3S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-(4-methylphenyl)oxiran-2-yl]stannane.
| Compound Name | tributyl-[(2S,3S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-(4-methylphenyl)oxiran-2-yl]stannane |
|---|---|
| PubChem CID | 10792071 |
| Molecular Formula | C26H43NO2Sn |
| Molecular Weight | 520.35 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | tributyl-[(2S,3S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-(4-methylphenyl)oxiran-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@]1(C2=NC(C)(C)CO2)O[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16NO2.3C4H9.Sn/c1-9-4-6-10(7-5-9)11-12(17-11)13-15-14(2,3)8-16-13;3*1-3-4-2;/h4-7,11H,8H2,1-3H3;3*1,3-4H2,2H3;/t11-;;;;/m0..../s1 |
| InChIKey | POLCKBVFEUVPBK-HZAYLZKLSA-N |
| XLogP | 7.40 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.35 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|