C19H25NO2 — CID 10590286
4,4-dimethyl-2-[(2R,3S)-2-(3-methylbut-2-enyl)-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazole (PubChem CID 10590286) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(2R,3S)-2-(3-methylbut-2-enyl)-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[(2R,3S)-2-(3-methylbut-2-enyl)-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 10590286 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 4,4-dimethyl-2-[(2R,3S)-2-(3-methylbut-2-enyl)-3-(4-methylphenyl)oxiran-2-yl]-5H-1,3-oxazole |
| SMILES | CC(C)=CC[C@@]1(C2=NC(C)(C)CO2)O[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C19H25NO2/c1-13(2)10-11-19(17-20-18(4,5)12-21-17)16(22-19)15-8-6-14(3)7-9-15/h6-10,16H,11-12H2,1-5H3/t16-,19+/m0/s1 |
| InChIKey | XRRACPHXQUMDFJ-QFBILLFUSA-N |
| XLogP | 4.37 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|