C21H23F2NO3 — CID 154721084
ethyl 2,2-difluoro-4-(4-phenylphenyl)-4-(propanoylamino)butanoate (PubChem CID 154721084) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is ethyl 2,2-difluoro-4-(4-phenylphenyl)-4-(propanoylamino)butanoate.
| Compound Name | ethyl 2,2-difluoro-4-(4-phenylphenyl)-4-(propanoylamino)butanoate |
|---|---|
| PubChem CID | 154721084 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | ethyl 2,2-difluoro-4-(4-phenylphenyl)-4-(propanoylamino)butanoate |
| SMILES | CCOC(=O)C(F)(F)CC(NC(=O)CC)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23F2NO3/c1-3-19(25)24-18(14-21(22,23)20(26)27-4-2)17-12-10-16(11-13-17)15-8-6-5-7-9-15/h5-13,18H,3-4,14H2,1-2H3,(H,24,25) |
| InChIKey | AGBKGYRMWCTIAJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |