C16H15NO4 — CID 154721096
ethyl (3R)-3-methyl-2-oxo-3,4-dihydrobenzo[h][1,4]benzoxazine-5-carboxylate (PubChem CID 154721096) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is ethyl (3R)-3-methyl-2-oxo-3,4-dihydrobenzo[h][1,4]benzoxazine-5-carboxylate.
| Compound Name | ethyl (3R)-3-methyl-2-oxo-3,4-dihydrobenzo[h][1,4]benzoxazine-5-carboxylate |
|---|---|
| PubChem CID | 154721096 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | ethyl (3R)-3-methyl-2-oxo-3,4-dihydrobenzo[h][1,4]benzoxazine-5-carboxylate |
| SMILES | CCOC(=O)c1cc2ccccc2c2c1N[C@H](C)C(=O)O2 |
| InChI | InChI=1S/C16H15NO4/c1-3-20-16(19)12-8-10-6-4-5-7-11(10)14-13(12)17-9(2)15(18)21-14/h4-9,17H,3H2,1-2H3/t9-/m1/s1 |
| InChIKey | DNAFSHGFICWEDH-SECBINFHSA-N |
| XLogP | 2.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|