C23H39NO4 — CID 154721401
[(1R)-2-[(2S,6R)-4-(but-3-enoylamino)-6-tert-butyloxan-2-yl]-1-cyclohexylethyl] acetate (PubChem CID 154721401) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is [(1R)-2-[(2S,6R)-4-(but-3-enoylamino)-6-tert-butyloxan-2-yl]-1-cyclohexylethyl] acetate.
| Compound Name | [(1R)-2-[(2S,6R)-4-(but-3-enoylamino)-6-tert-butyloxan-2-yl]-1-cyclohexylethyl] acetate |
|---|---|
| PubChem CID | 154721401 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | [(1R)-2-[(2S,6R)-4-(but-3-enoylamino)-6-tert-butyloxan-2-yl]-1-cyclohexylethyl] acetate |
| SMILES | C=CCC(=O)NC1C[C@@H](C[C@@H](OC(C)=O)C2CCCCC2)O[C@@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C23H39NO4/c1-6-10-22(26)24-18-13-19(28-21(14-18)23(3,4)5)15-20(27-16(2)25)17-11-8-7-9-12-17/h6,17-21H,1,7-15H2,2-5H3,(H,24,26)/t18?,19-,20+,21+/m0/s1 |
| InChIKey | ICOYFEPVIAGYGN-CIKZGZDFSA-N |
| XLogP | 4.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|