C22H37NO4 — CID 154721408
[(1R)-2-[(2S,6R)-6-tert-butyl-4-(prop-2-enoylamino)oxan-2-yl]-1-cyclohexylethyl] acetate (PubChem CID 154721408) has the molecular formula C22H37NO4 and a molecular weight of 379.54 g/mol. Its IUPAC name is [(1R)-2-[(2S,6R)-6-tert-butyl-4-(prop-2-enoylamino)oxan-2-yl]-1-cyclohexylethyl] acetate.
| Compound Name | [(1R)-2-[(2S,6R)-6-tert-butyl-4-(prop-2-enoylamino)oxan-2-yl]-1-cyclohexylethyl] acetate |
|---|---|
| PubChem CID | 154721408 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | [(1R)-2-[(2S,6R)-6-tert-butyl-4-(prop-2-enoylamino)oxan-2-yl]-1-cyclohexylethyl] acetate |
| SMILES | C=CC(=O)NC1C[C@@H](C[C@@H](OC(C)=O)C2CCCCC2)O[C@@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C22H37NO4/c1-6-21(25)23-17-12-18(27-20(13-17)22(3,4)5)14-19(26-15(2)24)16-10-8-7-9-11-16/h6,16-20H,1,7-14H2,2-5H3,(H,23,25)/t17?,18-,19+,20+/m0/s1 |
| InChIKey | HHTAFXJEBLNTIB-CBHJWYHGSA-N |
| XLogP | 4.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|