C28H40N6O5 — CID 154721432
(6S,9S,11R,12S,15S,18S)-15-benzyl-6-butan-2-yl-9,12-dimethyl-1,4,7,10,13,16-hexazatricyclo[16.3.0.07,11]henicosane-2,5,8,14,17-pentone (PubChem CID 154721432) has the molecular formula C28H40N6O5 and a molecular weight of 540.67 g/mol. Its IUPAC name is (6S,9S,11R,12S,15S,18S)-15-benzyl-6-butan-2-yl-9,12-dimethyl-1,4,7,10,13,16-hexazatricyclo[16.3.0.07,11]henicosane-2,5,8,14,17-pentone.
| Compound Name | (6S,9S,11R,12S,15S,18S)-15-benzyl-6-butan-2-yl-9,12-dimethyl-1,4,7,10,13,16-hexazatricyclo[16.3.0.07,11]henicosane-2,5,8,14,17-pentone |
|---|---|
| PubChem CID | 154721432 |
| Molecular Formula | C28H40N6O5 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (6S,9S,11R,12S,15S,18S)-15-benzyl-6-butan-2-yl-9,12-dimethyl-1,4,7,10,13,16-hexazatricyclo[16.3.0.07,11]henicosane-2,5,8,14,17-pentone |
| SMILES | CCC(C)[C@H]1C(=O)NCC(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](C)[C@@H]2N[C@@H](C)C(=O)N12 |
| InChI | InChI=1S/C28H40N6O5/c1-5-16(2)23-27(38)29-15-22(35)33-13-9-12-21(33)26(37)32-20(14-19-10-7-6-8-11-19)25(36)31-17(3)24-30-18(4)28(39)34(23)24/h6-8,10-11,16-18,20-21,23-24,30H,5,9,12-15H2,1-4H3,(H,29,38)(H,31,36)(H,32,37)/t16?,17-,18-,20-,21-,23-,24+/m0/s1 |
| InChIKey | RFMYLHXMNVIJQB-FDNXFSQRSA-N |
| XLogP | -0.10 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |