C11H21NO3 — CID 154721478
methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-3-hydroxypropanoate (PubChem CID 154721478) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 154721478 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-3-hydroxypropanoate |
| SMILES | CC/C=C/[C@H](CC)N[C@@H](CO)C(=O)OC |
| InChI | InChI=1S/C11H21NO3/c1-4-6-7-9(5-2)12-10(8-13)11(14)15-3/h6-7,9-10,12-13H,4-5,8H2,1-3H3/b7-6+/t9-,10-/m0/s1 |
| InChIKey | NTJJDHKNTJJBCW-CAFLDADYSA-N |
| XLogP | 0.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|