C20H27NO4Te — CID 154721669
1-O-tert-butyl 2-O-ethyl (2R,3Z)-2-methyl-3-(phenyltellanylmethylidene)pyrrolidine-1,2-dicarboxylate (PubChem CID 154721669) has the molecular formula C20H27NO4Te and a molecular weight of 473.04 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2R,3Z)-2-methyl-3-(phenyltellanylmethylidene)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2R,3Z)-2-methyl-3-(phenyltellanylmethylidene)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 154721669 |
| Molecular Formula | C20H27NO4Te |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2R,3Z)-2-methyl-3-(phenyltellanylmethylidene)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@]1(C)/C(=C\[Te]c2ccccc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27NO4Te/c1-6-24-17(22)20(5)15(14-26-16-10-8-7-9-11-16)12-13-21(20)18(23)25-19(2,3)4/h7-11,14H,6,12-13H2,1-5H3/b15-14-/t20-/m1/s1 |
| InChIKey | JWGTVHCGBDENFT-HMZRMUTASA-N |
| XLogP | 2.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|