C19H34O3Si — CID 154721709
[(1S,3R,4aS,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl] acetate (PubChem CID 154721709) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is [(1S,3R,4aS,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl] acetate.
| Compound Name | [(1S,3R,4aS,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 154721709 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | [(1S,3R,4aS,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](C)C[C@H]2CC(O[Si](C)(C)C(C)(C)C)=CC[C@H]21 |
| InChI | InChI=1S/C19H34O3Si/c1-13-10-15-12-16(22-23(6,7)19(3,4)5)8-9-17(15)18(11-13)21-14(2)20/h8,13,15,17-18H,9-12H2,1-7H3/t13-,15+,17-,18+/m1/s1 |
| InChIKey | MUMNMQQIJMOIMZ-SIUPPRGNSA-N |
| XLogP | 5.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|