C21H36O5Si — CID 14759348
[(1S,4aS,5R,8S,8aS)-8-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl] acetate (PubChem CID 14759348) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is [(1S,4aS,5R,8S,8aS)-8-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl] acetate.
| Compound Name | [(1S,4aS,5R,8S,8aS)-8-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 14759348 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | [(1S,4aS,5R,8S,8aS)-8-acetyloxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H]2CCC[C@H](OC(C)=O)[C@H]21 |
| InChI | InChI=1S/C21H36O5Si/c1-14(22)25-18-10-8-9-17-16(13-24-27(6,7)21(3,4)5)11-12-19(20(17)18)26-15(2)23/h11-12,16-20H,8-10,13H2,1-7H3/t16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | AGKTXSKPTFIFKG-HVTWWXFQSA-N |
| XLogP | 4.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|