C24H42O3Si — CID 10069933
methyl (E)-3-[(1S,2S,4aR,8S,8aS)-2-methyl-8-tri(propan-2-yl)silyloxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]prop-2-enoate (PubChem CID 10069933) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is methyl (E)-3-[(1S,2S,4aR,8S,8aS)-2-methyl-8-tri(propan-2-yl)silyloxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1S,2S,4aR,8S,8aS)-2-methyl-8-tri(propan-2-yl)silyloxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10069933 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | methyl (E)-3-[(1S,2S,4aR,8S,8aS)-2-methyl-8-tri(propan-2-yl)silyloxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1[C@H]2[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CCC[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C24H42O3Si/c1-16(2)28(17(3)4,18(5)6)27-22-11-9-10-20-13-12-19(7)21(24(20)22)14-15-23(25)26-8/h12-22,24H,9-11H2,1-8H3/b15-14+/t19-,20+,21-,22-,24-/m0/s1 |
| InChIKey | KSGGYFUUZDRWBO-PGCYVZTQSA-N |
| XLogP | 6.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|