C27H46O5Si — CID 154721875
methyl (2S,3S,4S,5S,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-4,5,6,8,10-pentamethyltricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate (PubChem CID 154721875) has the molecular formula C27H46O5Si and a molecular weight of 478.75 g/mol. Its IUPAC name is methyl (2S,3S,4S,5S,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-4,5,6,8,10-pentamethyltricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate.
| Compound Name | methyl (2S,3S,4S,5S,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-4,5,6,8,10-pentamethyltricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate |
|---|---|
| PubChem CID | 154721875 |
| Molecular Formula | C27H46O5Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | methyl (2S,3S,4S,5S,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)-4,5,6,8,10-pentamethyltricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate |
| SMILES | COCOC1C2C(C(=O)OC)C3(C)C=C(C)C2[C@@](C)([C@@H]1O[Si](C)(C)C(C)(C)C)[C@@H](C)/C(C)=C\3 |
| InChI | InChI=1S/C27H46O5Si/c1-16-13-26(7)14-17(2)20-19(21(26)24(28)30-10)22(31-15-29-9)23(27(20,8)18(16)3)32-33(11,12)25(4,5)6/h13-14,18-23H,15H2,1-12H3/b16-13-/t18-,19?,20?,21?,22?,23+,26?,27-/m0/s1 |
| InChIKey | NYCBWCCJSIIYGA-GQWFHXBYSA-N |
| XLogP | 5.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|