C26H44O3Si — CID 102197769
methyl (2S,3R,4S,5S,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,5,6,8,10-hexamethyltricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate (PubChem CID 102197769) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is methyl (2S,3R,4S,5S,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,5,6,8,10-hexamethyltricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate.
| Compound Name | methyl (2S,3R,4S,5S,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,5,6,8,10-hexamethyltricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate |
|---|---|
| PubChem CID | 102197769 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | methyl (2S,3R,4S,5S,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,5,6,8,10-hexamethyltricyclo[6.3.1.04,11]dodeca-6,9-diene-12-carboxylate |
| SMILES | COC(=O)C1C2C(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@]3(C)C2C(C)=CC1(C)/C=C(/C)[C@@H]3C |
| InChI | InChI=1S/C26H44O3Si/c1-15-13-25(8)14-16(2)20-19(21(25)23(27)28-10)17(3)22(26(20,9)18(15)4)29-30(11,12)24(5,6)7/h13-14,17-22H,1-12H3/b15-13-/t17?,18-,19?,20?,21?,22+,25?,26-/m0/s1 |
| InChIKey | IQIADTIEUGZKGW-YJEPUENQSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|