C23H38O3Si — CID 134889141
ethyl (9R)-9-[tert-butyl(dimethyl)silyl]oxy-10,10-dimethyl-6-methylidenetricyclo[6.3.0.01,5]undec-2-ene-2-carboxylate (PubChem CID 134889141) has the molecular formula C23H38O3Si and a molecular weight of 390.64 g/mol. Its IUPAC name is ethyl (9R)-9-[tert-butyl(dimethyl)silyl]oxy-10,10-dimethyl-6-methylidenetricyclo[6.3.0.01,5]undec-2-ene-2-carboxylate.
| Compound Name | ethyl (9R)-9-[tert-butyl(dimethyl)silyl]oxy-10,10-dimethyl-6-methylidenetricyclo[6.3.0.01,5]undec-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 134889141 |
| Molecular Formula | C23H38O3Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | ethyl (9R)-9-[tert-butyl(dimethyl)silyl]oxy-10,10-dimethyl-6-methylidenetricyclo[6.3.0.01,5]undec-2-ene-2-carboxylate |
| SMILES | C=C1CC2[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)CC23C(C(=O)OCC)=CCC13 |
| InChI | InChI=1S/C23H38O3Si/c1-10-25-20(24)17-12-11-16-15(2)13-18-19(22(6,7)14-23(16,17)18)26-27(8,9)21(3,4)5/h12,16,18-19H,2,10-11,13-14H2,1,3-9H3/t16?,18?,19-,23?/m1/s1 |
| InChIKey | NQSGKFWRTIHWFO-WZLIEPGHSA-N |
| XLogP | 5.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|