C20H36O3Si2 — CID 10762366
(3aS,3bR,4R,6aS,7S)-3a,5,5-trimethyl-4,7-bis(trimethylsilyloxy)-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one (PubChem CID 10762366) has the molecular formula C20H36O3Si2 and a molecular weight of 380.68 g/mol. Its IUPAC name is (3aS,3bR,4R,6aS,7S)-3a,5,5-trimethyl-4,7-bis(trimethylsilyloxy)-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one.
| Compound Name | (3aS,3bR,4R,6aS,7S)-3a,5,5-trimethyl-4,7-bis(trimethylsilyloxy)-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one |
|---|---|
| PubChem CID | 10762366 |
| Molecular Formula | C20H36O3Si2 |
| Molecular Weight | 380.68 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (3aS,3bR,4R,6aS,7S)-3a,5,5-trimethyl-4,7-bis(trimethylsilyloxy)-3,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-2-one |
| SMILES | CC1(C)C[C@H]2[C@@H]([C@H]1O[Si](C)(C)C)[C@]1(C)CC(=O)C=C1[C@H]2O[Si](C)(C)C |
| InChI | InChI=1S/C20H36O3Si2/c1-19(2)12-14-16(18(19)23-25(7,8)9)20(3)11-13(21)10-15(20)17(14)22-24(4,5)6/h10,14,16-18H,11-12H2,1-9H3/t14-,16-,17-,18+,20+/m0/s1 |
| InChIKey | TVOFZYZQJOCRQC-AACLIANESA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|