C26H39FO7Si — CID 70637638
[2-[(8S,9S,10R,13S,14S,17S)-6-fluoro-16,17-dihydroxy-10,13-dimethyl-3-oxo-11-trimethylsilyloxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 70637638) has the molecular formula C26H39FO7Si and a molecular weight of 510.68 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17S)-6-fluoro-16,17-dihydroxy-10,13-dimethyl-3-oxo-11-trimethylsilyloxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17S)-6-fluoro-16,17-dihydroxy-10,13-dimethyl-3-oxo-11-trimethylsilyloxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 70637638 |
| Molecular Formula | C26H39FO7Si |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17S)-6-fluoro-16,17-dihydroxy-10,13-dimethyl-3-oxo-11-trimethylsilyloxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)C(O)C[C@H]2[C@@H]3CC(F)C4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C)C[C@@]21C |
| InChI | InChI=1S/C26H39FO7Si/c1-14(28)33-13-22(31)26(32)21(30)11-17-16-10-19(27)18-9-15(29)7-8-24(18,2)23(16)20(12-25(17,26)3)34-35(4,5)6/h9,16-17,19-21,23,30,32H,7-8,10-13H2,1-6H3/t16-,17-,19?,20?,21?,23+,24-,25-,26-/m0/s1 |
| InChIKey | WOWYQATYEBBWLN-PWIUSCIISA-N |
| XLogP | 3.13 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|