C22H31ClO5 — CID 88831894
(6S,8S,9S,10R,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-11,16,17-trihydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 88831894) has the molecular formula C22H31ClO5 and a molecular weight of 410.94 g/mol. Its IUPAC name is (6S,8S,9S,10R,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-11,16,17-trihydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9S,10R,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-11,16,17-trihydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88831894 |
| Molecular Formula | C22H31ClO5 |
| Molecular Weight | 410.94 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (6S,8S,9S,10R,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-11,16,17-trihydroxy-6,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H]1C[C@@H]2[C@H]([C@@H](O)C[C@@]3(C)[C@H]2C[C@@H](O)[C@]3(O)C(=O)CCl)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C22H31ClO5/c1-11-6-13-15-8-17(26)22(28,18(27)10-23)21(15,3)9-16(25)19(13)20(2)5-4-12(24)7-14(11)20/h7,11,13,15-17,19,25-26,28H,4-6,8-10H2,1-3H3/t11-,13-,15-,16-,17+,19+,20-,21-,22-/m0/s1 |
| InChIKey | GOBHZTMEZCJZTH-LPCYWYEXSA-N |
| XLogP | 2.24 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.94 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|