C25H36O6 — CID 90478911
(1S,2S,4R,8S,9S,11S,12S,13R,19S)-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13,19-pentamethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one (PubChem CID 90478911) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is (1S,2S,4R,8S,9S,11S,12S,13R,19S)-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13,19-pentamethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one.
| Compound Name | (1S,2S,4R,8S,9S,11S,12S,13R,19S)-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13,19-pentamethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one |
|---|---|
| PubChem CID | 90478911 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (1S,2S,4R,8S,9S,11S,12S,13R,19S)-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13,19-pentamethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one |
| SMILES | C[C@H]1C[C@@H]2[C@H]([C@@H](O)C[C@@]3(C)[C@H]2C[C@H]2OC(C)(C)O[C@]23C(=O)CO)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C25H36O6/c1-13-8-15-17-10-20-25(19(29)12-26,31-22(2,3)30-20)24(17,5)11-18(28)21(15)23(4)7-6-14(27)9-16(13)23/h9,13,15,17-18,20-21,26,28H,6-8,10-12H2,1-5H3/t13-,15-,17-,18-,20+,21+,23-,24-,25+/m0/s1 |
| InChIKey | UCJFIFPQALSXQY-VEBXWIAYSA-N |
| XLogP | 2.80 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |