C24H35FO5 — CID 58701690
1-[(1S,2S,4R,8S,9S,11S,12S,13R,19S)-19-fluoro-11-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-8-yl]-2-hydroxyethanone (PubChem CID 58701690) has the molecular formula C24H35FO5 and a molecular weight of 422.54 g/mol. Its IUPAC name is 1-[(1S,2S,4R,8S,9S,11S,12S,13R,19S)-19-fluoro-11-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-8-yl]-2-hydroxyethanone.
| Compound Name | 1-[(1S,2S,4R,8S,9S,11S,12S,13R,19S)-19-fluoro-11-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-8-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 58701690 |
| Molecular Formula | C24H35FO5 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 1-[(1S,2S,4R,8S,9S,11S,12S,13R,19S)-19-fluoro-11-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-8-yl]-2-hydroxyethanone |
| SMILES | CC1(C)O[C@@H]2C[C@H]3[C@@H]4C[C@H](F)C5=CCCC[C@]5(C)[C@H]4[C@@H](O)C[C@]3(C)[C@]2(C(=O)CO)O1 |
| InChI | InChI=1S/C24H35FO5/c1-21(2)29-19-10-15-13-9-16(25)14-7-5-6-8-22(14,3)20(13)17(27)11-23(15,4)24(19,30-21)18(28)12-26/h7,13,15-17,19-20,26-27H,5-6,8-12H2,1-4H3/t13-,15-,16-,17-,19+,20+,22-,23-,24+/m0/s1 |
| InChIKey | BSHIFXYYSLUULF-LMVVAGHPSA-N |
| XLogP | 3.32 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|