C25H35FO6 — CID 53461486
12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13,19-pentamethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one (PubChem CID 53461486) has the molecular formula C25H35FO6 and a molecular weight of 450.55 g/mol. Its IUPAC name is 12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13,19-pentamethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one.
| Compound Name | 12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13,19-pentamethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one |
|---|---|
| PubChem CID | 53461486 |
| Molecular Formula | C25H35FO6 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13,19-pentamethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one |
| SMILES | CC1CC2C3CC4OC(C)(C)OC4(C(=O)CO)C3(C)CC(O)C2(F)C2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C25H35FO6/c1-13-8-17-16-10-20-25(19(30)12-27,32-21(2,3)31-20)23(16,5)11-18(29)24(17,26)22(4)7-6-14(28)9-15(13)22/h9,13,16-18,20,27,29H,6-8,10-12H2,1-5H3 |
| InChIKey | VMFNGSCUJOBFAZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |