C25H36O5 — CID 70406688
[(8S,9S,10R,13S,14S,17R)-17-acetyl-11-hydroxy-6,10,13,16-tetramethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 70406688) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-17-acetyl-11-hydroxy-6,10,13,16-tetramethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-17-acetyl-11-hydroxy-6,10,13,16-tetramethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 70406688 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-17-acetyl-11-hydroxy-6,10,13,16-tetramethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@]1(C(C)=O)C(C)C[C@H]2[C@@H]3CC(C)C4=CC(=O)CC[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C25H36O5/c1-13-9-18-20-10-14(2)25(15(3)26,30-16(4)27)24(20,6)12-21(29)22(18)23(5)8-7-17(28)11-19(13)23/h11,13-14,18,20-22,29H,7-10,12H2,1-6H3/t13?,14?,18-,20-,21?,22+,23-,24-,25-/m0/s1 |
| InChIKey | CPSIECYBNIRGFF-LQWYDQNZSA-N |
| XLogP | 3.87 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |