C21H28ClFO5 — CID 88831537
(6S,8S,9S,10R,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-6-fluoro-11,16,17-trihydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 88831537) has the molecular formula C21H28ClFO5 and a molecular weight of 414.90 g/mol. Its IUPAC name is (6S,8S,9S,10R,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-6-fluoro-11,16,17-trihydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9S,10R,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-6-fluoro-11,16,17-trihydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88831537 |
| Molecular Formula | C21H28ClFO5 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (6S,8S,9S,10R,11S,13S,14S,16R,17S)-17-(2-chloroacetyl)-6-fluoro-11,16,17-trihydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1[C@@H](F)C[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1C[C@@H](O)[C@]2(O)C(=O)CCl |
| InChI | InChI=1S/C21H28ClFO5/c1-19-4-3-10(24)5-13(19)14(23)6-11-12-7-16(26)21(28,17(27)9-22)20(12,2)8-15(25)18(11)19/h5,11-12,14-16,18,25-26,28H,3-4,6-9H2,1-2H3/t11-,12-,14-,15-,16+,18+,19-,20-,21-/m0/s1 |
| InChIKey | YOUBKSCAVWZUPA-WREZKNJXSA-N |
| XLogP | 1.95 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|