C17H28O3Si — CID 11243781
methyl (4S,5S,6S,9R)-9-[tert-butyl(dimethyl)silyl]oxytricyclo[4.3.0.01,4]non-2-ene-5-carboxylate (PubChem CID 11243781) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is methyl (4S,5S,6S,9R)-9-[tert-butyl(dimethyl)silyl]oxytricyclo[4.3.0.01,4]non-2-ene-5-carboxylate.
| Compound Name | methyl (4S,5S,6S,9R)-9-[tert-butyl(dimethyl)silyl]oxytricyclo[4.3.0.01,4]non-2-ene-5-carboxylate |
|---|---|
| PubChem CID | 11243781 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | methyl (4S,5S,6S,9R)-9-[tert-butyl(dimethyl)silyl]oxytricyclo[4.3.0.01,4]non-2-ene-5-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C=CC23[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]13 |
| InChI | InChI=1S/C17H28O3Si/c1-16(2,3)21(5,6)20-13-8-7-11-14(15(18)19-4)12-9-10-17(11,12)13/h9-14H,7-8H2,1-6H3/t11-,12-,13+,14-,17?/m0/s1 |
| InChIKey | NLCLQSWQSRFISG-CLDVFSPQSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|