C21H36O5Si — CID 102399514
methyl (3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-6-(3-methoxy-3-oxopropyl)-1,2,3,4,5,7a-hexahydroindene-3a-carboxylate (PubChem CID 102399514) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is methyl (3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-6-(3-methoxy-3-oxopropyl)-1,2,3,4,5,7a-hexahydroindene-3a-carboxylate.
| Compound Name | methyl (3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-6-(3-methoxy-3-oxopropyl)-1,2,3,4,5,7a-hexahydroindene-3a-carboxylate |
|---|---|
| PubChem CID | 102399514 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | methyl (3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-6-(3-methoxy-3-oxopropyl)-1,2,3,4,5,7a-hexahydroindene-3a-carboxylate |
| SMILES | COC(=O)CCC1=C[C@H]2CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C(=O)OC)CC1 |
| InChI | InChI=1S/C21H36O5Si/c1-20(2,3)27(6,7)26-17-10-9-16-14-15(8-11-18(22)24-4)12-13-21(16,17)19(23)25-5/h14,16-17H,8-13H2,1-7H3/t16-,17-,21-/m1/s1 |
| InChIKey | LTYRBPBHYOXRSD-CBGDNZLLSA-N |
| XLogP | 4.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|