C32H62O5Si2 — CID 15071512
methyl 7-[(1R,2R,3R)-2-[(E)-2,4-dimethyl-4-trimethylsilyloxyoct-1-enyl]-5-oxo-3-triethylsilyloxycyclopentyl]heptanoate (PubChem CID 15071512) has the molecular formula C32H62O5Si2 and a molecular weight of 583.02 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-[(E)-2,4-dimethyl-4-trimethylsilyloxyoct-1-enyl]-5-oxo-3-triethylsilyloxycyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-[(E)-2,4-dimethyl-4-trimethylsilyloxyoct-1-enyl]-5-oxo-3-triethylsilyloxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 15071512 |
| Molecular Formula | C32H62O5Si2 |
| Molecular Weight | 583.02 g/mol |
| Exact Mass | 582.41 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-[(E)-2,4-dimethyl-4-trimethylsilyloxyoct-1-enyl]-5-oxo-3-triethylsilyloxycyclopentyl]heptanoate |
| SMILES | CCCCC(C)(C/C(C)=C/[C@H]1[C@H](O[Si](CC)(CC)CC)CC(=O)[C@@H]1CCCCCCC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C32H62O5Si2/c1-11-15-22-32(6,37-38(8,9)10)25-26(5)23-28-27(20-18-16-17-19-21-31(34)35-7)29(33)24-30(28)36-39(12-2,13-3)14-4/h23,27-28,30H,11-22,24-25H2,1-10H3/b26-23+/t27-,28-,30-,32?/m1/s1 |
| InChIKey | MCVSZYGVZCSVSE-QNZYNUOCSA-N |
| XLogP | 9.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.02 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|