C35H68O6Si2 — CID 134901192
methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 134901192) has the molecular formula C35H68O6Si2 and a molecular weight of 641.09 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 134901192 |
| Molecular Formula | C35H68O6Si2 |
| Molecular Weight | 641.09 g/mol |
| Exact Mass | 640.46 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCC[C@@](C)(OC)[C@@H](/C=C/[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1CCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H68O6Si2/c1-15-16-25-35(8,39-10)31(41-43(13,14)34(5,6)7)24-23-28-27(21-19-17-18-20-22-32(37)38-9)29(36)26-30(28)40-42(11,12)33(2,3)4/h23-24,27-28,30-31H,15-22,25-26H2,1-14H3/b24-23+/t27-,28-,30-,31-,35-/m1/s1 |
| InChIKey | IAIZXPFJWPQSQJ-OZSANIDXSA-N |
| XLogP | 9.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.09 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|