C30H48O4Si — CID 11375486
[(E,3S)-1-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-but-2-ynyl-3-oxocyclopentyl]oct-1-en-3-yl] hept-5-ynoate (PubChem CID 11375486) has the molecular formula C30H48O4Si and a molecular weight of 500.80 g/mol. Its IUPAC name is [(E,3S)-1-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-but-2-ynyl-3-oxocyclopentyl]oct-1-en-3-yl] hept-5-ynoate.
| Compound Name | [(E,3S)-1-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-but-2-ynyl-3-oxocyclopentyl]oct-1-en-3-yl] hept-5-ynoate |
|---|---|
| PubChem CID | 11375486 |
| Molecular Formula | C30H48O4Si |
| Molecular Weight | 500.80 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | [(E,3S)-1-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-but-2-ynyl-3-oxocyclopentyl]oct-1-en-3-yl] hept-5-ynoate |
| SMILES | CC#CCCCC(=O)O[C@H](/C=C/[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1CC#CC)CCCCC |
| InChI | InChI=1S/C30H48O4Si/c1-9-12-15-17-20-29(32)33-24(18-16-13-10-2)21-22-26-25(19-14-11-3)27(31)23-28(26)34-35(7,8)30(4,5)6/h21-22,24-26,28H,10,13,15-20,23H2,1-8H3/b22-21+/t24-,25+,26+,28+/m0/s1 |
| InChIKey | KTBKDGZYKYQASK-UJPOUTJWSA-N |
| XLogP | 7.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.80 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|