C33H62O6Si2 — CID 10941082
methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]-6-oxoheptanoate (PubChem CID 10941082) has the molecular formula C33H62O6Si2 and a molecular weight of 611.02 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]-6-oxoheptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]-6-oxoheptanoate |
|---|---|
| PubChem CID | 10941082 |
| Molecular Formula | C33H62O6Si2 |
| Molecular Weight | 611.02 g/mol |
| Exact Mass | 610.41 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]-6-oxoheptanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1CC(=O)CCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H62O6Si2/c1-13-14-15-19-26(38-40(9,10)32(2,3)4)21-22-27-28(23-25(34)18-16-17-20-31(36)37-8)29(35)24-30(27)39-41(11,12)33(5,6)7/h21-22,26-28,30H,13-20,23-24H2,1-12H3/b22-21+/t26-,27+,28+,30+/m0/s1 |
| InChIKey | RRINOMFGVGKWCU-RMPVXFSGSA-N |
| XLogP | 8.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.02 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|