C10H10F6N2O — CID 154722224
2,2,2-trifluoro-1-[1-(trifluoromethyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-6-yl]ethanol (PubChem CID 154722224) has the molecular formula C10H10F6N2O and a molecular weight of 288.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-(trifluoromethyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-6-yl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[1-(trifluoromethyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-6-yl]ethanol |
|---|---|
| PubChem CID | 154722224 |
| Molecular Formula | C10H10F6N2O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-(trifluoromethyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazin-6-yl]ethanol |
| SMILES | OC(c1ccc2n1CCNC2C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6N2O/c11-9(12,13)7-5-1-2-6(8(19)10(14,15)16)18(5)4-3-17-7/h1-2,7-8,17,19H,3-4H2 |
| InChIKey | KXDKNNINCFPQLZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |