C12H8F12N2O — CID 154722292
2-[1,1-bis(trifluoromethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-6-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 154722292) has the molecular formula C12H8F12N2O and a molecular weight of 424.19 g/mol. Its IUPAC name is 2-[1,1-bis(trifluoromethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-6-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[1,1-bis(trifluoromethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-6-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 154722292 |
| Molecular Formula | C12H8F12N2O |
| Molecular Weight | 424.19 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 2-[1,1-bis(trifluoromethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-6-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccc2n1CCNC2(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F12N2O/c13-9(14,15)7(10(16,17)18)5-1-2-6(26(5)4-3-25-7)8(27,11(19,20)21)12(22,23)24/h1-2,25,27H,3-4H2 |
| InChIKey | DZQFNARXQDQMJC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |