C16H33LiOSi — CID 154722431
lithium tert-butyl-[(Z,4S)-dec-5-en-4-yl]oxy-dimethylsilane (PubChem CID 154722431) has the molecular formula C16H33LiOSi and a molecular weight of 276.47 g/mol. Its IUPAC name is lithium tert-butyl-[(Z,4S)-dec-5-en-4-yl]oxy-dimethylsilane.
| Compound Name | lithium tert-butyl-[(Z,4S)-dec-5-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 154722431 |
| Molecular Formula | C16H33LiOSi |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | lithium tert-butyl-[(Z,4S)-dec-5-en-4-yl]oxy-dimethylsilane |
| SMILES | C[CH-]C[C@@H](/C=C\CCCC)O[Si](C)(C)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C16H33OSi.Li/c1-8-10-11-12-14-15(13-9-2)17-18(6,7)16(3,4)5;/h9,12,14-15H,8,10-11,13H2,1-7H3;/q-1;+1/b14-12-;/t15-;/m0./s1 |
| InChIKey | LOVPQEAWECURMS-UVTWXFLPSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|