C20H21N3O2 — CID 154722735
1-benzyl-4-(3,5-dimethoxyphenyl)-5-prop-2-enyltriazole (PubChem CID 154722735) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-benzyl-4-(3,5-dimethoxyphenyl)-5-prop-2-enyltriazole.
| Compound Name | 1-benzyl-4-(3,5-dimethoxyphenyl)-5-prop-2-enyltriazole |
|---|---|
| PubChem CID | 154722735 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-benzyl-4-(3,5-dimethoxyphenyl)-5-prop-2-enyltriazole |
| SMILES | C=CCc1c(-c2cc(OC)cc(OC)c2)nnn1Cc1ccccc1 |
| InChI | InChI=1S/C20H21N3O2/c1-4-8-19-20(16-11-17(24-2)13-18(12-16)25-3)21-22-23(19)14-15-9-6-5-7-10-15/h4-7,9-13H,1,8,14H2,2-3H3 |
| InChIKey | GWRNNTSJQHEEPT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|