C18H36OSi — CID 154723421
trans-(1S,2S)-2-[(E)-3-tri(propan-2-yl)silylprop-1-enyl]cyclohexan-1-ol (PubChem CID 154723421) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(E)-3-tri(propan-2-yl)silylprop-1-enyl]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(E)-3-tri(propan-2-yl)silylprop-1-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 154723421 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | trans-(1S,2S)-2-[(E)-3-tri(propan-2-yl)silylprop-1-enyl]cyclohexan-1-ol |
| SMILES | CC(C)[Si](C/C=C/[C@@H]1CCCC[C@@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36OSi/c1-14(2)20(15(3)4,16(5)6)13-9-11-17-10-7-8-12-18(17)19/h9,11,14-19H,7-8,10,12-13H2,1-6H3/b11-9+/t17-,18-/m0/s1 |
| InChIKey | IHBJOCWXRWLVED-HNDWKTGHSA-N |
| XLogP | 5.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|