C24H21F14NOSi — CID 154723568
[bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-4,4-difluoropyrrolidin-2-yl]methoxy]-trimethylsilane (PubChem CID 154723568) has the molecular formula C24H21F14NOSi and a molecular weight of 633.50 g/mol. Its IUPAC name is [bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-4,4-difluoropyrrolidin-2-yl]methoxy]-trimethylsilane.
| Compound Name | [bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-4,4-difluoropyrrolidin-2-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 154723568 |
| Molecular Formula | C24H21F14NOSi |
| Molecular Weight | 633.50 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | [bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-4,4-difluoropyrrolidin-2-yl]methoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H]1CC(F)(F)CN1 |
| InChI | InChI=1S/C24H21F14NOSi/c1-41(2,3)40-20(18-10-19(25,26)11-39-18,12-4-14(21(27,28)29)8-15(5-12)22(30,31)32)13-6-16(23(33,34)35)9-17(7-13)24(36,37)38/h4-9,18,39H,10-11H2,1-3H3/t18-/m0/s1 |
| InChIKey | PHSZQQORLQMYDF-SFHVURJKSA-N |
| XLogP | 8.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.50 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|