C8H19BrN2O — CID 154724066
1-(1,4-dimethylpiperazin-1-ium-1-yl)ethanol bromide (PubChem CID 154724066) has the molecular formula C8H19BrN2O and a molecular weight of 239.16 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-1-ium-1-yl)ethanol bromide.
| Compound Name | 1-(1,4-dimethylpiperazin-1-ium-1-yl)ethanol bromide |
|---|---|
| PubChem CID | 154724066 |
| Molecular Formula | C8H19BrN2O |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-1-ium-1-yl)ethanol bromide |
| SMILES | CC(O)[N+]1(C)CCN(C)CC1.[Br-] |
| InChI | InChI=1S/C8H19N2O.BrH/c1-8(11)10(3)6-4-9(2)5-7-10;/h8,11H,4-7H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | SNOGBOBFVMBKHA-UHFFFAOYSA-M |
| XLogP | -3.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|