C17H16N4 — CID 154724374
6-N-(4-methyl-3-pyridinyl)-4-phenylpyridine-2,6-diamine (PubChem CID 154724374) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-N-(4-methyl-3-pyridinyl)-4-phenylpyridine-2,6-diamine.
| Compound Name | 6-N-(4-methyl-3-pyridinyl)-4-phenylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 154724374 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 6-N-(4-methyl-3-pyridinyl)-4-phenylpyridine-2,6-diamine |
| SMILES | Cc1ccncc1Nc1cc(-c2ccccc2)cc(N)n1 |
| InChI | InChI=1S/C17H16N4/c1-12-7-8-19-11-15(12)20-17-10-14(9-16(18)21-17)13-5-3-2-4-6-13/h2-11H,1H3,(H3,18,20,21) |
| InChIKey | DXZCGJJYWLMKAY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |