C21H28ClN3O3 — CID 154724431
N-[2-[4-[[4-(2-chloroacetyl)piperazin-1-yl]methyl]-6-methoxy-3H-inden-1-yl]ethyl]acetamide (PubChem CID 154724431) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is N-[2-[4-[[4-(2-chloroacetyl)piperazin-1-yl]methyl]-6-methoxy-3H-inden-1-yl]ethyl]acetamide.
| Compound Name | N-[2-[4-[[4-(2-chloroacetyl)piperazin-1-yl]methyl]-6-methoxy-3H-inden-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 154724431 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-[2-[4-[[4-(2-chloroacetyl)piperazin-1-yl]methyl]-6-methoxy-3H-inden-1-yl]ethyl]acetamide |
| SMILES | COc1cc(CN2CCN(C(=O)CCl)CC2)c2c(c1)C(CCNC(C)=O)=CC2 |
| InChI | InChI=1S/C21H28ClN3O3/c1-15(26)23-6-5-16-3-4-19-17(11-18(28-2)12-20(16)19)14-24-7-9-25(10-8-24)21(27)13-22/h3,11-12H,4-10,13-14H2,1-2H3,(H,23,26) |
| InChIKey | NJXAVCBJCXPACB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|