C20H20Cl2N2O3 — CID 154725028
N-[(E)-4-acetamido-1-(3-chlorophenyl)-4-(4-hydroxyphenyl)but-2-enyl]-2-chloroacetamide (PubChem CID 154725028) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is N-[(E)-4-acetamido-1-(3-chlorophenyl)-4-(4-hydroxyphenyl)but-2-enyl]-2-chloroacetamide.
| Compound Name | N-[(E)-4-acetamido-1-(3-chlorophenyl)-4-(4-hydroxyphenyl)but-2-enyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 154725028 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[(E)-4-acetamido-1-(3-chlorophenyl)-4-(4-hydroxyphenyl)but-2-enyl]-2-chloroacetamide |
| SMILES | CC(=O)NC(/C=C/C(NC(=O)CCl)c1cccc(Cl)c1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c1-13(25)23-18(14-5-7-17(26)8-6-14)9-10-19(24-20(27)12-21)15-3-2-4-16(22)11-15/h2-11,18-19,26H,12H2,1H3,(H,23,25)(H,24,27)/b10-9+ |
| InChIKey | CNENHPTYXOWWDZ-MDZDMXLPSA-N |
| XLogP | 3.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|