C7H2BrCl2N3 — CID 154728648
6-bromo-2,3-dichloropyrido[2,3-b]pyrazine (PubChem CID 154728648) has the molecular formula C7H2BrCl2N3 and a molecular weight of 278.92 g/mol. Its IUPAC name is 6-bromo-2,3-dichloropyrido[2,3-b]pyrazine.
| Compound Name | 6-bromo-2,3-dichloropyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 154728648 |
| Molecular Formula | C7H2BrCl2N3 |
| Molecular Weight | 278.92 g/mol |
| Exact Mass | 276.88 |
| IUPAC Name | 6-bromo-2,3-dichloropyrido[2,3-b]pyrazine |
| SMILES | Clc1nc2ccc(Br)nc2nc1Cl |
| InChI | InChI=1S/C7H2BrCl2N3/c8-4-2-1-3-7(12-4)13-6(10)5(9)11-3/h1-2H |
| InChIKey | LKAZZLBPPMSVBL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.92 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|