About 2-bromo-8-chloro-1,5-naphthyridine
2-bromo-8-chloro-1,5-naphthyridine (PubChem CID 96880051) has the molecular formula C8H4BrClN2
and a molecular weight of 243.49 g/mol. Its IUPAC name is 2-bromo-8-chloro-1,5-naphthyridine.
Molecular Properties
| Compound Name | 2-bromo-8-chloro-1,5-naphthyridine |
| PubChem CID | 96880051 |
| Molecular Formula | C8H4BrClN2 |
| Molecular Weight | 243.49 g/mol |
| Exact Mass | 241.92 |
| IUPAC Name | 2-bromo-8-chloro-1,5-naphthyridine |
| SMILES | Clc1ccnc2ccc(Br)nc12 |
| InChI | InChI=1S/C8H4BrClN2/c9-7-2-1-6-8(12-7)5(10)3-4-11-6/h1-4H |
| InChIKey | DYCFODZITDVHCL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-8-chloro-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-8-chloro-1,5-naphthyridine?
The IUPAC name of 2-bromo-8-chloro-1,5-naphthyridine (CID 96880051) is 2-bromo-8-chloro-1,5-naphthyridine.
What is the SMILES notation for 2-bromo-8-chloro-1,5-naphthyridine?
The canonical SMILES for 2-bromo-8-chloro-1,5-naphthyridine is Clc1ccnc2ccc(Br)nc12.
What is the InChIKey of 2-bromo-8-chloro-1,5-naphthyridine?
The InChIKey is DYCFODZITDVHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrClN2/c9-7-2-1-6-8(12-7)5(10)3-4-11-6/h1-4H.
What are the key properties of 2-bromo-8-chloro-1,5-naphthyridine?
2-bromo-8-chloro-1,5-naphthyridine has a molecular weight of 243.49 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-8-chloro-1,5-naphthyridine is sourced from PubChem (CID 96880051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).