C12H13ClN2O — CID 602071
2-butoxy-8-chloro-1,5-naphthyridine (PubChem CID 602071) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 2-butoxy-8-chloro-1,5-naphthyridine.
| Compound Name | 2-butoxy-8-chloro-1,5-naphthyridine |
|---|---|
| PubChem CID | 602071 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-butoxy-8-chloro-1,5-naphthyridine |
| SMILES | CCCCOc1ccc2nccc(Cl)c2n1 |
| InChI | InChI=1S/C12H13ClN2O/c1-2-3-8-16-11-5-4-10-12(15-11)9(13)6-7-14-10/h4-7H,2-3,8H2,1H3 |
| InChIKey | ZRGJXDDUIQLMGP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|