C14H24O3 — CID 154731549
methyl 2-[(2R,3R,5R,6S)-6-[(2R)-but-3-en-2-yl]-3,5-dimethyloxan-2-yl]acetate (PubChem CID 154731549) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is methyl 2-[(2R,3R,5R,6S)-6-[(2R)-but-3-en-2-yl]-3,5-dimethyloxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,5R,6S)-6-[(2R)-but-3-en-2-yl]-3,5-dimethyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 154731549 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | methyl 2-[(2R,3R,5R,6S)-6-[(2R)-but-3-en-2-yl]-3,5-dimethyloxan-2-yl]acetate |
| SMILES | C=C[C@@H](C)[C@H]1O[C@H](CC(=O)OC)[C@H](C)C[C@H]1C |
| InChI | InChI=1S/C14H24O3/c1-6-9(2)14-11(4)7-10(3)12(17-14)8-13(15)16-5/h6,9-12,14H,1,7-8H2,2-5H3/t9-,10-,11-,12-,14-/m1/s1 |
| InChIKey | DGDPOCPRZQHEKA-CBLPJQPBSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|