About 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one
5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one (PubChem CID 154732272) has the molecular formula C16H18O4
and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one.
Molecular Properties
| Compound Name | 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one |
| PubChem CID | 154732272 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one |
| SMILES | COCCc1cc2c(c3c1C=CC(C)(C)O3)COC2=O |
| InChI | InChI=1S/C16H18O4/c1-16(2)6-4-11-10(5-7-18-3)8-12-13(14(11)20-16)9-19-15(12)17/h4,6,8H,5,7,9H2,1-3H3 |
| InChIKey | MOMLXUFDSOSMIZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one?
The IUPAC name of 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one (CID 154732272) is 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one.
What is the SMILES notation for 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one?
The canonical SMILES for 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one is COCCc1cc2c(c3c1C=CC(C)(C)O3)COC2=O.
What is the InChIKey of 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one?
The InChIKey is MOMLXUFDSOSMIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O4/c1-16(2)6-4-11-10(5-7-18-3)8-12-13(14(11)20-16)9-19-15(12)17/h4,6,8H,5,7,9H2,1-3H3.
What are the key properties of 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one?
5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one has a molecular weight of 274.32 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one is sourced from PubChem (CID 154732272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).