C16H18O4 — CID 154732272
5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one (PubChem CID 154732272) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one.
| Compound Name | 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one |
|---|---|
| PubChem CID | 154732272 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 5-(2-methoxyethyl)-2,2-dimethyl-9H-furo[3,4-h]chromen-7-one |
| SMILES | COCCc1cc2c(c3c1C=CC(C)(C)O3)COC2=O |
| InChI | InChI=1S/C16H18O4/c1-16(2)6-4-11-10(5-7-18-3)8-12-13(14(11)20-16)9-19-15(12)17/h4,6,8H,5,7,9H2,1-3H3 |
| InChIKey | MOMLXUFDSOSMIZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |