C18H22BrNO2 — CID 154732547
ethyl (E,2S)-6-bromo-2-cyano-2-(3-phenylpropyl)hex-3-enoate (PubChem CID 154732547) has the molecular formula C18H22BrNO2 and a molecular weight of 364.28 g/mol. Its IUPAC name is ethyl (E,2S)-6-bromo-2-cyano-2-(3-phenylpropyl)hex-3-enoate.
| Compound Name | ethyl (E,2S)-6-bromo-2-cyano-2-(3-phenylpropyl)hex-3-enoate |
|---|---|
| PubChem CID | 154732547 |
| Molecular Formula | C18H22BrNO2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | ethyl (E,2S)-6-bromo-2-cyano-2-(3-phenylpropyl)hex-3-enoate |
| SMILES | CCOC(=O)[C@](C#N)(/C=C/CCBr)CCCc1ccccc1 |
| InChI | InChI=1S/C18H22BrNO2/c1-2-22-17(21)18(15-20,12-6-7-14-19)13-8-11-16-9-4-3-5-10-16/h3-6,9-10,12H,2,7-8,11,13-14H2,1H3/b12-6+/t18-/m1/s1 |
| InChIKey | WMGWGTQOBRYBFC-NORHQAJESA-N |
| XLogP | 4.42 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|