C19H17ClN6O — CID 154732821
6-chloro-3-[(1S)-1-[[4-(5-methyl-1H-pyrazol-4-yl)pyrimidin-2-yl]amino]ethyl]-6H-quinolin-2-one (PubChem CID 154732821) has the molecular formula C19H17ClN6O and a molecular weight of 380.84 g/mol. Its IUPAC name is 6-chloro-3-[(1S)-1-[[4-(5-methyl-1H-pyrazol-4-yl)pyrimidin-2-yl]amino]ethyl]-6H-quinolin-2-one.
| Compound Name | 6-chloro-3-[(1S)-1-[[4-(5-methyl-1H-pyrazol-4-yl)pyrimidin-2-yl]amino]ethyl]-6H-quinolin-2-one |
|---|---|
| PubChem CID | 154732821 |
| Molecular Formula | C19H17ClN6O |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 6-chloro-3-[(1S)-1-[[4-(5-methyl-1H-pyrazol-4-yl)pyrimidin-2-yl]amino]ethyl]-6H-quinolin-2-one |
| SMILES | Cc1[nH]ncc1-c1ccnc(N[C@@H](C)C2=CC3=CC(Cl)C=CC3=NC2=O)n1 |
| InChI | InChI=1S/C19H17ClN6O/c1-10(14-8-12-7-13(20)3-4-16(12)24-18(14)27)23-19-21-6-5-17(25-19)15-9-22-26-11(15)2/h3-10,13H,1-2H3,(H,22,26)(H,21,23,25)/t10-,13?/m0/s1 |
| InChIKey | DQDNOQMOJXSOGQ-NKUHCKNESA-N |
| XLogP | 2.99 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|