C10H22F12N4P2 — CID 154734092
[(Z)-3-(dimethylamino)-2-(dimethylaminomethylideneamino)prop-2-enylidene]-dimethylazanium;hydron;dihexafluorophosphate (PubChem CID 154734092) has the molecular formula C10H22F12N4P2 and a molecular weight of 488.24 g/mol. Its IUPAC name is [(Z)-3-(dimethylamino)-2-(dimethylaminomethylideneamino)prop-2-enylidene]-dimethylazanium;hydron;dihexafluorophosphate.
| Compound Name | [(Z)-3-(dimethylamino)-2-(dimethylaminomethylideneamino)prop-2-enylidene]-dimethylazanium;hydron;dihexafluorophosphate |
|---|---|
| PubChem CID | 154734092 |
| Molecular Formula | C10H22F12N4P2 |
| Molecular Weight | 488.24 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | [(Z)-3-(dimethylamino)-2-(dimethylaminomethylideneamino)prop-2-enylidene]-dimethylazanium;hydron;dihexafluorophosphate |
| SMILES | CN(C)/C=C(C=[N+](C)C)\N=C\N(C)C.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.[H+] |
| InChI | InChI=1S/C10H21N4.2F6P/c1-12(2)7-10(8-13(3)4)11-9-14(5)6;2*1-7(2,3,4,5)6/h7-9H,1-6H3;;/q+1;2*-1/p+1/b11-9+;; |
| InChIKey | KFTDGHRJKJYFSJ-OTBYXNOXSA-O |
| XLogP | 7.20 |
| TPSA | 21.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.24 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|